Drugs present in MMsINC which are similar to the molecule MMscode: MMs03306972
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725773![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.75 |
MMs01727287![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.75 |
MMs01725538![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.75 |
MMs01725828![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.75 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.72 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725513![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01725511![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01725366![]() | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01724764![]() | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725049![]() | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.70 |
MMs01725327![]() | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01725325![]() | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01725323![]() | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.70 |