Drugs present in MMsINC which are similar to the molecule MMscode: MMs03296572
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725592![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.86 |
MMs01725593![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.86 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.79 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.79 |
MMs01725217![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(N2c3c(NC2=O)cccc3)=CC1 | 0.72 |