Drugs present in MMsINC which are similar to the molecule MMscode: MMs03290383
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726032 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.72 |
MMs01726033 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.72 |
MMs01726034 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.72 |
MMs01726035 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.72 |
MMs01727373 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.70 |
MMs01727374 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.70 |
MMs01727375 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.70 |
MMs01727376 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.70 |