Drugs present in MMsINC which are similar to the molecule MMscode: MMs03289033
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725120![]() | [nH]1cc(nc1)CCN | 0.93 |
MMs01727280![]() | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.75 |
MMs01727282![]() | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.75 |
MMs01727284![]() | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.75 |
MMs01726460![]() | S(Cc1[nH+]c[nH]c1C)CCN\C(=N/C#N)\NC | 0.72 |