Drugs present in MMsINC which are similar to the molecule MMscode: MMs03284141
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725217![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(N2c3c(NC2=O)cccc3)=CC1 | 0.72 |
MMs01725141![]() | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01726917![]() | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01724926![]() | O=C1N=C(c2c(N1C(C)C)cc(cc2)C)c1ccccc1 | 0.72 |
MMs01724833![]() | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.70 |
MMs01725438![]() | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.70 |