Drugs present in MMsINC which are similar to the molecule MMscode: MMs03275867
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.76 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.75 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.72 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |