Drugs present in MMsINC which are similar to the molecule MMscode: MMs03268546
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.81 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.77 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.76 |
MMs01725065 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.73 |
MMs01725067 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.73 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.73 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |