Drugs present in MMsINC which are similar to the molecule MMscode: MMs03239879
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725923![]() | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.76 |
MMs01724971![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.75 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.75 |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.75 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.75 |
MMs01726069![]() | Oc1c(O)c(O)ccc1CNNC(=O)C(N)CO | 0.72 |
MMs01726068![]() | Oc1c(O)c(O)ccc1CNNC(=O)C(N)CO | 0.72 |
MMs01725039![]() | Oc1cc(ccc1O)CC(NN)(C(O)=O)C | 0.71 |
MMs01725041![]() | Oc1cc(ccc1O)CC(NN)(C(O)=O)C | 0.71 |