Drugs present in MMsINC which are similar to the molecule MMscode: MMs03216461
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.80 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.79 |
MMs01725895 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.76 |
MMs01727297 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.76 |
MMs01726609 | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.74 |
MMs01725190 | Clc1cc(O)c(cc1S(=O)(=O)N)C(=O)Nc1c(cccc1C)C | 0.73 |