Drugs present in MMsINC which are similar to the molecule MMscode: MMs03214610
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725383![]() | OC1CC(CCC1C(C)C)C | 0.75 |
MMs01726145![]() | OC1C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C(CC1)=C | 0.71 |
MMs01726146![]() | OC1C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C(CC1)=C | 0.71 |
MMs01726147![]() | OC1C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C(CC1)=C | 0.71 |
MMs01726148![]() | OC1C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C(CC1)=C | 0.71 |