Drugs present in MMsINC which are similar to the molecule MMscode: MMs03214383
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.74 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.73 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |