Drugs present in MMsINC which are similar to the molecule MMscode: MMs03214075
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.74 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.74 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.74 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.73 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.73 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.72 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.72 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |