Drugs present in MMsINC which are similar to the molecule MMscode: MMs03212352
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724733 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.75 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.74 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.72 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.71 |