Drugs present in MMsINC which are similar to the molecule MMscode: MMs03209783
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725414![]() | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.79 |
MMs01725149![]() | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.76 |
MMs01726757![]() | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.76 |
MMs01725126![]() | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.76 |
MMs01727376![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727373![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727374![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727375![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |