Drugs present in MMsINC which are similar to the molecule MMscode: MMs03188840
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.73 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.73 |
MMs01725185![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.72 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.71 |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.71 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.71 |
MMs01725761![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725763![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725759![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725757![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |