Drugs present in MMsINC which are similar to the molecule MMscode: MMs03186423
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725495![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.80 |
MMs01725497![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.80 |
MMs01725499![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.80 |
MMs01725501![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.80 |
MMs01724819![]() | s1cccc1C(c1sccc1)=C1CCC[NH+](C1)C | 0.77 |