Drugs present in MMsINC which are similar to the molecule MMscode: MMs03179220
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727057 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.73 |
MMs01727059 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.73 |
MMs01725162 | Clc1cc2c(cc1)C(c1ncccc1CC2)=C1CCN(CC1)C(OCC)=O | 0.72 |
MMs01725173 | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC2(SCC(=O)N2)CC1 | 0.71 |
MMs01725165 | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC(CC1)C(=O)N | 0.71 |