Drugs present in MMsINC which are similar to the molecule MMscode: MMs03168124
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727453 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.75 |
MMs01727451 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.75 |
MMs01727449 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.75 |
MMs01727455 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.75 |
MMs01727424 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01725811 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01725851 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01727422 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01725777 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.70 |
MMs01726213 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.70 |
MMs01726211 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.70 |
MMs01726209 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.70 |
MMs01726207 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.70 |
MMs01726823 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.70 |
MMs01726821 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.70 |
MMs01726825 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.70 |