Drugs present in MMsINC which are similar to the molecule MMscode: MMs03158636
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725169![]() | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.84 |
MMs01724870![]() | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.77 |
MMs01726487![]() | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.76 |
MMs01724731![]() | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.75 |
MMs01726820![]() | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.73 |
MMs01726819![]() | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.73 |
MMs01724772![]() | O1C(CNC1=O)COc1ccccc1OC | 0.71 |
MMs01725806![]() | O1C(CNC1=O)COc1ccccc1OC | 0.71 |