Drugs present in MMsINC which are similar to the molecule MMscode: MMs03131135
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725125![]() | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.80 |
MMs01725127![]() | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.80 |
MMs01727507![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.73 |
MMs01727505![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.73 |
MMs01725834![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01725836![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01726759![]() | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |
MMs01726761![]() | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |
MMs01726763![]() | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |
MMs01726765![]() | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |