Drugs present in MMsINC which are similar to the molecule MMscode: MMs03106868
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724907![]() | Clc1cc2c(-n3c(CN=C2c2ccccc2F)c[nH+]c3C)cc1 | 0.82 |
MMs01725089![]() | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.79 |
MMs01725102![]() | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.75 |
MMs01725100![]() | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.75 |
MMs01725012![]() | Clc1c(cccc1Cl)-c1nnc(nc1N)N | 0.72 |
MMs01726741![]() | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.72 |
MMs01724991![]() | [NH+](CCc1c2cc(ccc2[nH]c1)Cn1ncnc1)(C)C | 0.71 |
MMs01724945![]() | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.71 |
MMs01724884![]() | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.70 |