Drugs present in MMsINC which are similar to the molecule MMscode: MMs03101625
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.77 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.77 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01724764![]() | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01726106![]() | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.72 |
MMs01726108![]() | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.72 |
MMs01725087![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01724795![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.72 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.70 |