Drugs present in MMsINC which are similar to the molecule MMscode: MMs03099847
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724978 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.75 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.75 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.75 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.73 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.72 |
MMs01725660 | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |
MMs01725549 | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.70 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.70 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.70 |