Drugs present in MMsINC which are similar to the molecule MMscode: MMs03091872
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727039 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.76 |
MMs01727040 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.76 |
MMs01727041 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.76 |
MMs01727690 | O1C(C)C(O)C(N)C(O)C1OC1\C=C\C=C\C=C\C=C\CC(OC(=O)\C=C\C2OC2CC(O)CC2(OC(C1)C(C(O)=O)C(O)C2)O)C | 0.71 |
MMs01727691 | O1C(C)C(O)C(N)C(O)C1OC1\C=C\C=C\C=C\C=C\CC(OC(=O)\C=C\C2OC2CC(O)CC2(OC(C1)C(C(O)=O)C(O)C2)O)C | 0.71 |