Drugs present in MMsINC which are similar to the molecule MMscode: MMs03089997
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727206![]() | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.73 |
MMs01727207![]() | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.73 |
MMs01727537![]() | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.73 |
MMs01725106![]() | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.72 |
MMs01725107![]() | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.72 |