Drugs present in MMsINC which are similar to the molecule MMscode: MMs03087431
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.77 |
MMs01725588 | Clc1cc(N)ccc1C(OCCN(CC)CC)=O | 0.72 |
MMs01725190 | Clc1cc(O)c(cc1S(=O)(=O)N)C(=O)Nc1c(cccc1C)C | 0.72 |
MMs01724812 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.71 |
MMs01725319 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.71 |