Drugs present in MMsINC which are similar to the molecule MMscode: MMs03084513
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724953![]() | OC(=O)C1CCn2c1ccc2C(=O)c1ccccc1 | 0.76 |
MMs01725010![]() | OC(=O)C1CCn2c1ccc2C(=O)c1ccccc1 | 0.76 |
MMs01725096![]() | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.75 |
MMs01725710![]() | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.72 |
MMs01726780![]() | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.72 |
MMs01726778![]() | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.72 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.70 |
MMs01725701![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.70 |
MMs01725025![]() | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.70 |
MMs01724998![]() | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.70 |
MMs01725615![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.70 |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.70 |