Drugs present in MMsINC which are similar to the molecule MMscode: MMs03081485
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727181![]() | O1C2C34CCN(C(Cc5c3c1c(OC)cc5)C4(O)CCC2=O)C | 0.72 |
MMs01725128![]() | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=O)CC=C | 0.72 |
MMs01727183![]() | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=O)C | 0.72 |
MMs01725423![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)CCC2=O | 0.70 |
MMs01725768![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |
MMs01727279![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |
MMs01727278![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |
MMs01725671![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |