Drugs present in MMsINC which are similar to the molecule MMscode: MMs03081303
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.97 |
MMs01725451 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.80 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.75 |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.74 |
MMs01724867 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.73 |
MMs01726520 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.73 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.72 |
MMs01726137 | OC12C3(CCCC1)CCN(C2Cc1c3cc(O)cc1)CC1CCC1 | 0.71 |
MMs01725392 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.70 |
MMs01724743 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.70 |
MMs01726518 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.70 |
MMs01726519 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.70 |