Drugs present in MMsINC which are similar to the molecule MMscode: MMs03080195
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01727287 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01726387 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.71 |
MMs01726389 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.71 |
MMs01726391 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.71 |
MMs01726393 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.71 |
MMs01725697 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01725600 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01725598 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01725699 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |