Drugs present in MMsINC which are similar to the molecule MMscode: MMs03079879
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725693 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726919 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726920 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726921 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726019 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |
MMs01726014 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |
MMs01726016 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |
MMs01726018 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |