Drugs present in MMsINC which are similar to the molecule MMscode: MMs03079879
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725693![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726919![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726920![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726921![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726019![]() | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |
MMs01726014![]() | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |
MMs01726016![]() | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |
MMs01726018![]() | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.71 |