Drugs present in MMsINC which are similar to the molecule MMscode: MMs03054192
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725089 | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.83 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.74 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.74 |
MMs01725411 | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.74 |
MMs01725429 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.73 |
MMs01725443 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.73 |