Drugs present in MMsINC which are similar to the molecule MMscode: MMs03039393
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724741![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.73 |
MMs01726475![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.73 |
MMs01724806![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.72 |
MMs01725741![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.72 |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |
MMs01724846![]() | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.71 |








