Drugs present in MMsINC which are similar to the molecule MMscode: MMs03036270
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724937 | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.78 |
MMs01725173 | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC2(SCC(=O)N2)CC1 | 0.72 |
MMs01724984 | s1c2Nc3c(N=C(N4CC[NH+](CC4)C)c2cc1C)cccc3 | 0.72 |
MMs01724778 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |
MMs01725302 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |
MMs01724862 | Clc1cc2c(Sc3c(N=C2N2CC[NH+](CC2)C)cccc3)cc1 | 0.71 |