Drugs present in MMsINC which are similar to the molecule MMscode: MMs03034051
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726450 | S(O)(=O)(=O)c1cc(N=Nc2ccc(cc2)-c2ccc(N=Nc3cc(S(O)(=O)=O)c4c(cccc4)c3N)cc2)c(N)c2c1cccc2 | 0.77 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.75 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.74 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.73 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.73 |
MMs01725438 | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.72 |