Drugs present in MMsINC which are similar to the molecule MMscode: MMs03032539
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724890![]() | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.74 |
MMs01725225![]() | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.74 |
MMs01727381![]() | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.74 |
MMs01725683![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.70 |
MMs01725685![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.70 |