Drugs present in MMsINC which are similar to the molecule MMscode: MMs03028700
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725049![]() | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.82 |
MMs01724727![]() | Brc1ccc(cc1)C(OCCN(C)C)c1ccccc1 | 0.81 |
MMs01726473![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.76 |
MMs01724857![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.76 |
MMs01725133![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.76 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725087![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725189![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CC2[N+]3(C(C1)CC2)CCCC3 | 0.70 |