Drugs present in MMsINC which are similar to the molecule MMscode: MMs03025026
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724816![]() | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.84 |
MMs01724957![]() | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.84 |
MMs01727385![]() | S(=O)(C)c1ccc(cc1)\C=C/1\c2c(cc(F)cc2)C(CC(O)=O)=C\1C | 0.75 |
MMs01726870![]() | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726868![]() | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726869![]() | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726871![]() | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726872![]() | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726873![]() | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01724997![]() | S(=O)(=O)(C)c1ccc(cc1)C=1COC(=O)C=1c1ccccc1 | 0.72 |
MMs01725182![]() | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.72 |
MMs01727430![]() | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.72 |