Drugs present in MMsINC which are similar to the molecule MMscode: MMs03019899
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727533![]() | OC(=O)CCCCCCC\C=C/CCCCCCCC | 0.73 |
MMs01725931![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.70 |
MMs01727039![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.70 |
MMs01727040![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.70 |
MMs01727041![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.70 |