Drugs present in MMsINC which are similar to the molecule MMscode: MMs03017060
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.75 |
MMs01725897 | O(C)c1cc(C)c(\C=C\C(=C/C=C/C(=C\C(O)=O)/C)\C)c(C)c1C | 0.75 |
MMs01725668 | Oc1ccc(cc1)CC(N)C | 0.73 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.71 |
MMs01724900 | Oc1c2c(cccc2)c(O)cc1C | 0.71 |