Drugs present in MMsINC which are similar to the molecule MMscode: MMs03002809
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.81 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.81 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.74 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.74 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.71 |