Drugs present in MMsINC which are similar to the molecule MMscode: MMs02999178
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.76 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.76 |
MMs01725525 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.75 |
MMs01725524 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.75 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.75 |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.72 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.70 |