Drugs present in MMsINC which are similar to the molecule MMscode: MMs02909499
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725461![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.74 |
MMs01725463![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.74 |
MMs01725532![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.74 |
MMs01725530![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.74 |
MMs01725739![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.74 |
MMs01724729![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.74 |
MMs01725342![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C1CCCC1 | 0.73 |
MMs01724915![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C1CCCC1 | 0.73 |
MMs01725459![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.73 |
MMs01725457![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.73 |
MMs01725721![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.73 |
MMs01725338![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.73 |
MMs01725943![]() | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.72 |
MMs01725723![]() | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.72 |
MMs01725364![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01725362![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01725015![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.72 |
MMs01725104![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.72 |
MMs01724733![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.72 |
MMs01725286![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.72 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |
MMs01725292![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |