Drugs present in MMsINC which are similar to the molecule MMscode: MMs02886865
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.82 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.82 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.79 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.76 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.76 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.76 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.76 |
MMs01725733 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.74 |
MMs01725734 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.74 |
MMs01725735 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.74 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.72 |
MMs01725446 | [NH3+]C1CC1c1ccccc1 | 0.71 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.70 |