Drugs present in MMsINC which are similar to the molecule MMscode: MMs02881675
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725261![]() | O(CC)c1cc(ccc1OCC)Cc1nccc2c1cc(OCC)c(OCC)c2 | 0.81 |
MMs01725112![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.78 |
MMs01724747![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.78 |
MMs01727243![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.76 |
MMs01724808![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.76 |
MMs01725051![]() | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.74 |
MMs01725053![]() | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.74 |
MMs01725408![]() | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.74 |
MMs01724927![]() | O(C(=O)N(C)C)c1ccc[n+](c1)C | 0.73 |
MMs01724839![]() | Oc1ncc(cc1N)-c1ccncc1 | 0.72 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01725701![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01724962![]() | Oc1nc(C)c(cc1C#N)-c1ccncc1 | 0.71 |
MMs01726858![]() | Ic1cc(I)c2c(nccc2)c1O | 0.70 |
















