Drugs present in MMsINC which are similar to the molecule MMscode: MMs02864579
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727365 | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.77 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.72 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.70 |