Drugs present in MMsINC which are similar to the molecule MMscode: MMs02863709
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725261 | O(CC)c1cc(ccc1OCC)Cc1nccc2c1cc(OCC)c(OCC)c2 | 0.79 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.77 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.77 |
MMs01725934 | S(=O)(=O)(Nc1cc(OC)c(Nc2c3c(nc4c2cccc4)cccc3)cc1)C | 0.76 |
MMs01726858 | Ic1cc(I)c2c(nccc2)c1O | 0.75 |
MMs01725053 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.75 |
MMs01725051 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.75 |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.70 |
MMs01725701 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.70 |