Drugs present in MMsINC which are similar to the molecule MMscode: MMs02861539
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.76 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.76 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.75 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.75 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.75 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.75 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.73 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.72 |
MMs01727222 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01724917 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01725372 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01727220 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01725715 | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.70 |