Drugs present in MMsINC which are similar to the molecule MMscode: MMs02858857
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.70 |