Drugs present in MMsINC which are similar to the molecule MMscode: MMs02851470
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725031![]() | S1Cc2c(cccc2)\C(\c2c1cccc2)=C/CC[NH+](C)C | 0.76 |
MMs01725243![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.74 |
MMs01725644![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.74 |
MMs01725645![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.74 |
MMs01725176![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.74 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01727424![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01725811![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01725851![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01727422![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |